C18H23NO4S — CID 18860548
2-(5-tert-butyl-1-benzofuran-3-yl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 18860548) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 2-(5-tert-butyl-1-benzofuran-3-yl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(5-tert-butyl-1-benzofuran-3-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 18860548 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-(5-tert-butyl-1-benzofuran-3-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC(C)(C)c1ccc2occ(CC(=O)NC3CCS(=O)(=O)C3)c2c1 |
| InChI | InChI=1S/C18H23NO4S/c1-18(2,3)13-4-5-16-15(9-13)12(10-23-16)8-17(20)19-14-6-7-24(21,22)11-14/h4-5,9-10,14H,6-8,11H2,1-3H3,(H,19,20) |
| InChIKey | YVMJTWGWWFXNLZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |