C13H14N2O4S — CID 110771780
2-(1,3-benzoxazol-6-yl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 110771780) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-yl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(1,3-benzoxazol-6-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 110771780 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(1,3-benzoxazol-6-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(Cc1ccc2ncoc2c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14N2O4S/c16-13(15-10-3-4-20(17,18)7-10)6-9-1-2-11-12(5-9)19-8-14-11/h1-2,5,8,10H,3-4,6-7H2,(H,15,16) |
| InChIKey | CWLYSUZBOPUOLQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |