C13H14N2O5S — CID 110773979
N-(1,1-dioxothiolan-3-yl)-2-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide (PubChem CID 110773979) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110773979 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide |
| SMILES | O=C(Cc1ccc2oc(=O)[nH]c2c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14N2O5S/c16-12(14-9-3-4-21(18,19)7-9)6-8-1-2-11-10(5-8)15-13(17)20-11/h1-2,5,9H,3-4,6-7H2,(H,14,16)(H,15,17) |
| InChIKey | IVOIOFDMALPDNF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |