C16H17NO5S — CID 40643679
N-[(3R)-1,1-dioxothiolan-3-yl]-6-ethyl-4-oxochromene-2-carboxamide (PubChem CID 40643679) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-6-ethyl-4-oxochromene-2-carboxamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-6-ethyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 40643679 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-6-ethyl-4-oxochromene-2-carboxamide |
| SMILES | CCc1ccc2oc(C(=O)N[C@@H]3CCS(=O)(=O)C3)cc(=O)c2c1 |
| InChI | InChI=1S/C16H17NO5S/c1-2-10-3-4-14-12(7-10)13(18)8-15(22-14)16(19)17-11-5-6-23(20,21)9-11/h3-4,7-8,11H,2,5-6,9H2,1H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | MPXLMDDFCYUNQS-LLVKDONJSA-N |
| XLogP | 1.27 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |