C18H19N3O5S — CID 109237228
methyl 4-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]-3-pyridinyl]amino]benzoate (PubChem CID 109237228) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl 4-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109237228 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | methyl 4-[[5-[(1,1-dioxothiolan-3-yl)carbamoyl]-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cncc(C(=O)NC3CCS(=O)(=O)C3)c2)cc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-26-18(23)12-2-4-14(5-3-12)20-16-8-13(9-19-10-16)17(22)21-15-6-7-27(24,25)11-15/h2-5,8-10,15,20H,6-7,11H2,1H3,(H,21,22) |
| InChIKey | NYZGMYXZYHSWFB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |