C19H23N3O4S — CID 109237215
N-(1,1-dioxothiolan-3-yl)-5-(4-propan-2-yloxyanilino)pyridine-3-carboxamide (PubChem CID 109237215) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-(4-propan-2-yloxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-(4-propan-2-yloxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237215 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-(4-propan-2-yloxyanilino)pyridine-3-carboxamide |
| SMILES | CC(C)Oc1ccc(Nc2cncc(C(=O)NC3CCS(=O)(=O)C3)c2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-13(2)26-18-5-3-15(4-6-18)21-17-9-14(10-20-11-17)19(23)22-16-7-8-27(24,25)12-16/h3-6,9-11,13,16,21H,7-8,12H2,1-2H3,(H,22,23) |
| InChIKey | PJMMSFVTUQGFOV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |