C15H23N3O2 — CID 111159976
3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1,2-dimethylguanidine (PubChem CID 111159976) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1,2-dimethylguanidine.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111159976 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1,2-dimethylguanidine |
| SMILES | CCCCN(C)/C(=N\C)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H23N3O2/c1-4-5-8-18(3)15(16-2)17-10-12-6-7-13-14(9-12)20-11-19-13/h6-7,9H,4-5,8,10-11H2,1-3H3,(H,16,17) |
| InChIKey | MPXUPGDOLXLLPU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|