C15H25IN4O2 — CID 111845316
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111845316) has the molecular formula C15H25IN4O2 and a molecular weight of 420.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111845316 |
| Molecular Formula | C15H25IN4O2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[ethyl(methyl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(C)CCN/C(=N\C)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C15H24N4O2.HI/c1-4-19(3)8-7-17-15(16-2)18-10-12-5-6-13-14(9-12)21-11-20-13;/h5-6,9H,4,7-8,10-11H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | HQHUFIBXLBPBIZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|