C18H29IN4O4 — CID 111843669
tert-butyl N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide (PubChem CID 111843669) has the molecular formula C18H29IN4O4 and a molecular weight of 492.36 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111843669 |
| Molecular Formula | C18H29IN4O4 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | tert-butyl N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide |
| SMILES | C/N=C(\NCCN(C)C(=O)OC(C)(C)C)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C18H28N4O4.HI/c1-18(2,3)26-17(23)22(5)9-8-20-16(19-4)21-11-13-6-7-14-15(10-13)25-12-24-14;/h6-7,10H,8-9,11-12H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | WJXYKSKIUDZKBF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|