C13H26N2O3S — CID 109003500
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(pentylamino)acetamide (PubChem CID 109003500) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(pentylamino)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(pentylamino)acetamide |
|---|---|
| PubChem CID | 109003500 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(pentylamino)acetamide |
| SMILES | CCCCCNCC(=O)N(CC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26N2O3S/c1-3-5-6-8-14-10-13(16)15(4-2)12-7-9-19(17,18)11-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | SUVMMPYTJNNWBC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|