C16H22Cl2N2O3S — CID 109003507
2-[2-(2,4-dichlorophenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide (PubChem CID 109003507) has the molecular formula C16H22Cl2N2O3S and a molecular weight of 393.34 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 109003507 |
| Molecular Formula | C16H22Cl2N2O3S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethylamino]-N-(1,1-dioxothiolan-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)CNCCc1ccc(Cl)cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22Cl2N2O3S/c1-2-20(14-6-8-24(22,23)11-14)16(21)10-19-7-5-12-3-4-13(17)9-15(12)18/h3-4,9,14,19H,2,5-8,10-11H2,1H3 |
| InChIKey | BWHGEYXSRMZPAD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|