C17H26N2O4S — CID 109001150
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[2-(4-methoxyphenyl)ethylamino]acetamide (PubChem CID 109001150) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[2-(4-methoxyphenyl)ethylamino]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[2-(4-methoxyphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 109001150 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-[2-(4-methoxyphenyl)ethylamino]acetamide |
| SMILES | CCN(C(=O)CNCCc1ccc(OC)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O4S/c1-3-19(15-9-11-24(21,22)13-15)17(20)12-18-10-8-14-4-6-16(23-2)7-5-14/h4-7,15,18H,3,8-13H2,1-2H3 |
| InChIKey | HBSZZANQZANJFT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|