C19H34N2O4S — CID 109149349
4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-1-N-pentylcyclohexane-1,4-dicarboxamide (PubChem CID 109149349) has the molecular formula C19H34N2O4S and a molecular weight of 386.56 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-1-N-pentylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-1-N-pentylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149349 |
| Molecular Formula | C19H34N2O4S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-1-N-pentylcyclohexane-1,4-dicarboxamide |
| SMILES | CCCCCNC(=O)C1CCC(C(=O)N(CC)C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C19H34N2O4S/c1-3-5-6-12-20-18(22)15-7-9-16(10-8-15)19(23)21(4-2)17-11-13-26(24,25)14-17/h15-17H,3-14H2,1-2H3,(H,20,22) |
| InChIKey | UAULDBIEFYZPTM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|