C15H19FN2O4S — CID 108985174
N'-(1,1-dioxothiolan-3-yl)-N-[2-(2-fluorophenyl)ethyl]-N'-methyloxamide (PubChem CID 108985174) has the molecular formula C15H19FN2O4S and a molecular weight of 342.39 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-[2-(2-fluorophenyl)ethyl]-N'-methyloxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-[2-(2-fluorophenyl)ethyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 108985174 |
| Molecular Formula | C15H19FN2O4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-[2-(2-fluorophenyl)ethyl]-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)NCCc1ccccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19FN2O4S/c1-18(12-7-9-23(21,22)10-12)15(20)14(19)17-8-6-11-4-2-3-5-13(11)16/h2-5,12H,6-10H2,1H3,(H,17,19) |
| InChIKey | GRGRDNSRCMMTSD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|