C20H16FN3O2 — CID 108982341
1-N-(2-fluorophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide (PubChem CID 108982341) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is 1-N-(2-fluorophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(2-fluorophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982341 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-N-(2-fluorophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccccc1F)C1(C(=O)Nc2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C20H16FN3O2/c21-14-7-1-2-8-15(14)23-18(25)20(10-11-20)19(26)24-16-9-3-5-13-6-4-12-22-17(13)16/h1-9,12H,10-11H2,(H,23,25)(H,24,26) |
| InChIKey | UWEYCRAGCSBRAQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|