C21H16N4O2 — CID 108983729
1-N-(3-cyanophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide (PubChem CID 108983729) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1-N-(3-cyanophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(3-cyanophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108983729 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-N-(3-cyanophenyl)-1-N'-quinolin-8-ylcyclopropane-1,1-dicarboxamide |
| SMILES | N#Cc1cccc(NC(=O)C2(C(=O)Nc3cccc4cccnc34)CC2)c1 |
| InChI | InChI=1S/C21H16N4O2/c22-13-14-4-1-7-16(12-14)24-19(26)21(9-10-21)20(27)25-17-8-2-5-15-6-3-11-23-18(15)17/h1-8,11-12H,9-10H2,(H,24,26)(H,25,27) |
| InChIKey | PXJHHWBDPJLNRJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|