C21H27N3O11 — CID 6434410
bis((Z)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)ethyl 1-oxidopyridin-1-ium-3-carboxylate (PubChem CID 6434410) has the molecular formula C21H27N3O11 and a molecular weight of 497.46 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)ethyl 1-oxidopyridin-1-ium-3-carboxylate.
| Compound Name | bis((Z)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)ethyl 1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6434410 |
| Molecular Formula | C21H27N3O11 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);2-(4-methylpiperazin-1-yl)ethyl 1-oxidopyridin-1-ium-3-carboxylate |
| SMILES | CN1CCN(CCOC(=O)c2ccc[n+]([O-])c2)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H19N3O3.2C4H4O4/c1-14-5-7-15(8-6-14)9-10-19-13(17)12-3-2-4-16(18)11-12;2*5-3(6)1-2-4(7)8/h2-4,11H,5-10H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | YUWORNGRHKXMRM-SPIKMXEPSA-N |
| XLogP | -0.85 |
| TPSA | 208.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|