C25H30F2N2O4 — CID 50896865
3-[4-[3-(4-fluorobenzoyl)oxypropyl]-1,4-diazepan-1-yl]propyl 4-fluorobenzoate (PubChem CID 50896865) has the molecular formula C25H30F2N2O4 and a molecular weight of 460.52 g/mol. Its IUPAC name is 3-[4-[3-(4-fluorobenzoyl)oxypropyl]-1,4-diazepan-1-yl]propyl 4-fluorobenzoate.
| Compound Name | 3-[4-[3-(4-fluorobenzoyl)oxypropyl]-1,4-diazepan-1-yl]propyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 50896865 |
| Molecular Formula | C25H30F2N2O4 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-[4-[3-(4-fluorobenzoyl)oxypropyl]-1,4-diazepan-1-yl]propyl 4-fluorobenzoate |
| SMILES | O=C(OCCCN1CCCN(CCCOC(=O)c2ccc(F)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H30F2N2O4/c26-22-8-4-20(5-9-22)24(30)32-18-2-14-28-12-1-13-29(17-16-28)15-3-19-33-25(31)21-6-10-23(27)11-7-21/h4-11H,1-3,12-19H2 |
| InChIKey | WMTBYCBWGMRRQA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|