C31H40N2O5 — CID 154145730
bis(3-piperidin-1-ylpropyl) 9H-xanthene-2,7-dicarboxylate (PubChem CID 154145730) has the molecular formula C31H40N2O5 and a molecular weight of 520.67 g/mol. Its IUPAC name is bis(3-piperidin-1-ylpropyl) 9H-xanthene-2,7-dicarboxylate.
| Compound Name | bis(3-piperidin-1-ylpropyl) 9H-xanthene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 154145730 |
| Molecular Formula | C31H40N2O5 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | bis(3-piperidin-1-ylpropyl) 9H-xanthene-2,7-dicarboxylate |
| SMILES | O=C(OCCCN1CCCCC1)c1ccc2c(c1)Cc1cc(C(=O)OCCCN3CCCCC3)ccc1O2 |
| InChI | InChI=1S/C31H40N2O5/c34-30(36-19-7-17-32-13-3-1-4-14-32)24-9-11-28-26(21-24)23-27-22-25(10-12-29(27)38-28)31(35)37-20-8-18-33-15-5-2-6-16-33/h9-12,21-22H,1-8,13-20,23H2 |
| InChIKey | DXPRZPRDSUECKZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|