C17H18N2O4S — CID 20564274
pentyl 4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxylate (PubChem CID 20564274) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is pentyl 4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | pentyl 4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 20564274 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | pentyl 4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxylate |
| SMILES | CCCCCOC(=O)c1ccc2c(c1)Cc1c([nH]c(=S)[nH]c1=O)O2 |
| InChI | InChI=1S/C17H18N2O4S/c1-2-3-4-7-22-16(21)10-5-6-13-11(8-10)9-12-14(20)18-17(24)19-15(12)23-13/h5-6,8H,2-4,7,9H2,1H3,(H2,18,19,20,24) |
| InChIKey | PVPKAMQHNHSSMZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|