C16H17N3O3S — CID 20564243
N,N-diethyl-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide (PubChem CID 20564243) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N,N-diethyl-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N,N-diethyl-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 20564243 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N,N-diethyl-4-oxo-2-sulfanylidene-1,5-dihydrochromeno[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)Cc1c([nH]c(=S)[nH]c1=O)O2 |
| InChI | InChI=1S/C16H17N3O3S/c1-3-19(4-2)15(21)9-5-6-12-10(7-9)8-11-13(20)17-16(23)18-14(11)22-12/h5-7H,3-4,8H2,1-2H3,(H2,17,18,20,23) |
| InChIKey | IZGGJJSHFXKZOZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|