About pentyl 4-amino-3-iodobenzoate
pentyl 4-amino-3-iodobenzoate (PubChem CID 44829102) has the molecular formula C12H16INO2
and a molecular weight of 333.17 g/mol. Its IUPAC name is pentyl 4-amino-3-iodobenzoate.
Molecular Properties
| Compound Name | pentyl 4-amino-3-iodobenzoate |
| PubChem CID | 44829102 |
| Molecular Formula | C12H16INO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | pentyl 4-amino-3-iodobenzoate |
| SMILES | CCCCCOC(=O)c1ccc(N)c(I)c1 |
| InChI | InChI=1S/C12H16INO2/c1-2-3-4-7-16-12(15)9-5-6-11(14)10(13)8-9/h5-6,8H,2-4,7,14H2,1H3 |
| InChIKey | NDFXZCWMHBUJCD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze pentyl 4-amino-3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 4-amino-3-iodobenzoate?
The IUPAC name of pentyl 4-amino-3-iodobenzoate (CID 44829102) is pentyl 4-amino-3-iodobenzoate.
What is the SMILES notation for pentyl 4-amino-3-iodobenzoate?
The canonical SMILES for pentyl 4-amino-3-iodobenzoate is CCCCCOC(=O)c1ccc(N)c(I)c1.
What is the InChIKey of pentyl 4-amino-3-iodobenzoate?
The InChIKey is NDFXZCWMHBUJCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16INO2/c1-2-3-4-7-16-12(15)9-5-6-11(14)10(13)8-9/h5-6,8H,2-4,7,14H2,1H3.
What are the key properties of pentyl 4-amino-3-iodobenzoate?
pentyl 4-amino-3-iodobenzoate has a molecular weight of 333.17 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 4-amino-3-iodobenzoate is sourced from PubChem (CID 44829102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).