C31H40Cl2N2O5-2 — CID 21419602
1,3-bis(3-piperidin-1-ylpropyl)-9H-xanthene-2,7-dicarboxylate;dihydrochloride (PubChem CID 21419602) has the molecular formula C31H40Cl2N2O5-2 and a molecular weight of 591.58 g/mol. Its IUPAC name is 1,3-bis(3-piperidin-1-ylpropyl)-9H-xanthene-2,7-dicarboxylate;dihydrochloride.
| Compound Name | 1,3-bis(3-piperidin-1-ylpropyl)-9H-xanthene-2,7-dicarboxylate;dihydrochloride |
|---|---|
| PubChem CID | 21419602 |
| Molecular Formula | C31H40Cl2N2O5-2 |
| Molecular Weight | 591.58 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 1,3-bis(3-piperidin-1-ylpropyl)-9H-xanthene-2,7-dicarboxylate;dihydrochloride |
| SMILES | Cl.Cl.O=C([O-])c1ccc2c(c1)Cc1c(cc(CCCN3CCCCC3)c(C(=O)[O-])c1CCCN1CCCCC1)O2 |
| InChI | InChI=1S/C31H40N2O5.2ClH/c34-30(35)23-11-12-27-24(19-23)20-26-25(10-8-18-33-15-5-2-6-16-33)29(31(36)37)22(21-28(26)38-27)9-7-17-32-13-3-1-4-14-32;;/h11-12,19,21H,1-10,13-18,20H2,(H,34,35)(H,36,37);2*1H/p-2 |
| InChIKey | JJYPHSGKTVISBM-UHFFFAOYSA-L |
| XLogP | 3.79 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |