C31H40N2O — CID 6445981
1-[(E)-4-[7-[(E)-4-piperidin-1-ylbut-1-enyl]-9H-xanthen-2-yl]but-3-enyl]piperidine (PubChem CID 6445981) has the molecular formula C31H40N2O and a molecular weight of 456.67 g/mol. Its IUPAC name is 1-[(E)-4-[7-[(E)-4-piperidin-1-ylbut-1-enyl]-9H-xanthen-2-yl]but-3-enyl]piperidine.
| Compound Name | 1-[(E)-4-[7-[(E)-4-piperidin-1-ylbut-1-enyl]-9H-xanthen-2-yl]but-3-enyl]piperidine |
|---|---|
| PubChem CID | 6445981 |
| Molecular Formula | C31H40N2O |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 1-[(E)-4-[7-[(E)-4-piperidin-1-ylbut-1-enyl]-9H-xanthen-2-yl]but-3-enyl]piperidine |
| SMILES | C(=C/c1ccc2c(c1)Cc1cc(/C=C/CCN3CCCCC3)ccc1O2)\CCN1CCCCC1 |
| InChI | InChI=1S/C31H40N2O/c1-5-17-32(18-6-1)21-9-3-11-26-13-15-30-28(23-26)25-29-24-27(14-16-31(29)34-30)12-4-10-22-33-19-7-2-8-20-33/h3-4,11-16,23-24H,1-2,5-10,17-22,25H2/b11-3+,12-4+ |
| InChIKey | STMXCMSCKUEUDE-HMMKTVFPSA-N |
| XLogP | 7.16 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |