C17H23NO3 — CID 86621824
1-[3-[(E)-3-(3H-1,2-benzodioxol-5-yl)prop-2-enoxy]propyl]pyrrolidine (PubChem CID 86621824) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 1-[3-[(E)-3-(3H-1,2-benzodioxol-5-yl)prop-2-enoxy]propyl]pyrrolidine.
| Compound Name | 1-[3-[(E)-3-(3H-1,2-benzodioxol-5-yl)prop-2-enoxy]propyl]pyrrolidine |
|---|---|
| PubChem CID | 86621824 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[3-[(E)-3-(3H-1,2-benzodioxol-5-yl)prop-2-enoxy]propyl]pyrrolidine |
| SMILES | C(=C/c1ccc2c(c1)COO2)\COCCCN1CCCC1 |
| InChI | InChI=1S/C17H23NO3/c1-2-9-18(8-1)10-4-12-19-11-3-5-15-6-7-17-16(13-15)14-20-21-17/h3,5-7,13H,1-2,4,8-12,14H2/b5-3+ |
| InChIKey | GVQQFNBRRWFULL-HWKANZROSA-N |
| XLogP | 3.03 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|