C20H23NO6 — CID 143322498
2-[1-[3-[(E)-3-(1-benzofuran-5-yl)prop-2-enoxy]propyl]pyrrolidin-3-yl]oxy-2-oxoacetic acid (PubChem CID 143322498) has the molecular formula C20H23NO6 and a molecular weight of 373.40 g/mol. Its IUPAC name is 2-[1-[3-[(E)-3-(1-benzofuran-5-yl)prop-2-enoxy]propyl]pyrrolidin-3-yl]oxy-2-oxoacetic acid.
| Compound Name | 2-[1-[3-[(E)-3-(1-benzofuran-5-yl)prop-2-enoxy]propyl]pyrrolidin-3-yl]oxy-2-oxoacetic acid |
|---|---|
| PubChem CID | 143322498 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[1-[3-[(E)-3-(1-benzofuran-5-yl)prop-2-enoxy]propyl]pyrrolidin-3-yl]oxy-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)OC1CCN(CCCOC/C=C/c2ccc3occc3c2)C1 |
| InChI | InChI=1S/C20H23NO6/c22-19(23)20(24)27-17-6-9-21(14-17)8-2-11-25-10-1-3-15-4-5-18-16(13-15)7-12-26-18/h1,3-5,7,12-13,17H,2,6,8-11,14H2,(H,22,23)/b3-1+ |
| InChIKey | VATPEIHDGBKCOR-HNQUOIGGSA-N |
| XLogP | 2.55 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|