C31H40N2O2S — CID 21419575
4-piperidin-1-yl-1-[8-(4-piperidin-1-ylbutanoyl)-9H-thioxanthen-2-yl]butan-1-one (PubChem CID 21419575) has the molecular formula C31H40N2O2S and a molecular weight of 504.74 g/mol. Its IUPAC name is 4-piperidin-1-yl-1-[8-(4-piperidin-1-ylbutanoyl)-9H-thioxanthen-2-yl]butan-1-one.
| Compound Name | 4-piperidin-1-yl-1-[8-(4-piperidin-1-ylbutanoyl)-9H-thioxanthen-2-yl]butan-1-one |
|---|---|
| PubChem CID | 21419575 |
| Molecular Formula | C31H40N2O2S |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 4-piperidin-1-yl-1-[8-(4-piperidin-1-ylbutanoyl)-9H-thioxanthen-2-yl]butan-1-one |
| SMILES | O=C(CCCN1CCCCC1)c1ccc2c(c1)Cc1c(cccc1C(=O)CCCN1CCCCC1)S2 |
| InChI | InChI=1S/C31H40N2O2S/c34-28(11-8-20-32-16-3-1-4-17-32)24-14-15-30-25(22-24)23-27-26(10-7-13-31(27)36-30)29(35)12-9-21-33-18-5-2-6-19-33/h7,10,13-15,22H,1-6,8-9,11-12,16-21,23H2 |
| InChIKey | MKYDAQQDKSACHJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |