C33H36N2O2S — CID 58538908
(2E)-2-[[4-[4-(azepan-1-yl)butanoyl]phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one (PubChem CID 58538908) has the molecular formula C33H36N2O2S and a molecular weight of 524.73 g/mol. Its IUPAC name is (2E)-2-[[4-[4-(azepan-1-yl)butanoyl]phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-[[4-[4-(azepan-1-yl)butanoyl]phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 58538908 |
| Molecular Formula | C33H36N2O2S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | (2E)-2-[[4-[4-(azepan-1-yl)butanoyl]phenyl]methylidene]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(CN2C(=O)/C(=C\c3ccc(C(=O)CCCN4CCCCCC4)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C33H36N2O2S/c1-25-10-8-11-27(22-25)24-35-29-12-4-5-14-31(29)38-32(33(35)37)23-26-15-17-28(18-16-26)30(36)13-9-21-34-19-6-2-3-7-20-34/h4-5,8,10-12,14-18,22-23H,2-3,6-7,9,13,19-21,24H2,1H3/b32-23+ |
| InChIKey | OAHUKUCMMSPICK-AWSUPERCSA-N |
| XLogP | 7.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|