C35H40N2O2S — CID 58538988
(2Z)-2-benzylidene-6-[5-[cyclohexyl(methyl)amino]pentanoyl]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one (PubChem CID 58538988) has the molecular formula C35H40N2O2S and a molecular weight of 552.78 g/mol. Its IUPAC name is (2Z)-2-benzylidene-6-[5-[cyclohexyl(methyl)amino]pentanoyl]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-benzylidene-6-[5-[cyclohexyl(methyl)amino]pentanoyl]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 58538988 |
| Molecular Formula | C35H40N2O2S |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | (2Z)-2-benzylidene-6-[5-[cyclohexyl(methyl)amino]pentanoyl]-4-[(3-methylphenyl)methyl]-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(CN2C(=O)/C(=C/c3ccccc3)Sc3ccc(C(=O)CCCCN(C)C4CCCCC4)cc32)c1 |
| InChI | InChI=1S/C35H40N2O2S/c1-26-12-11-15-28(22-26)25-37-31-24-29(32(38)18-9-10-21-36(2)30-16-7-4-8-17-30)19-20-33(31)40-34(35(37)39)23-27-13-5-3-6-14-27/h3,5-6,11-15,19-20,22-24,30H,4,7-10,16-18,21,25H2,1-2H3/b34-23- |
| InChIKey | KNZHJLYASRHCGL-XSVYLIDLSA-N |
| XLogP | 8.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|