C32H34N2O2S — CID 6086400
(2Z)-2-benzylidene-N-(2,3-dimethylcyclohexyl)-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 6086400) has the molecular formula C32H34N2O2S and a molecular weight of 510.70 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-(2,3-dimethylcyclohexyl)-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-(2,3-dimethylcyclohexyl)-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6086400 |
| Molecular Formula | C32H34N2O2S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (2Z)-2-benzylidene-N-(2,3-dimethylcyclohexyl)-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(CN2C(=O)/C(=C/c3ccccc3)Sc3ccc(C(=O)NC4CCCC(C)C4C)cc32)c1 |
| InChI | InChI=1S/C32H34N2O2S/c1-21-9-7-13-25(17-21)20-34-28-19-26(31(35)33-27-14-8-10-22(2)23(27)3)15-16-29(28)37-30(32(34)36)18-24-11-5-4-6-12-24/h4-7,9,11-13,15-19,22-23,27H,8,10,14,20H2,1-3H3,(H,33,35)/b30-18- |
| InChIKey | XKOJTKZGTIWZNK-YKQZZPSBSA-N |
| XLogP | 7.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|