C20H38N6O5 — CID 88955263
ethyl 2-[8,11-bis(2-amino-2-oxoethyl)-4-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate (PubChem CID 88955263) has the molecular formula C20H38N6O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is ethyl 2-[8,11-bis(2-amino-2-oxoethyl)-4-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate.
| Compound Name | ethyl 2-[8,11-bis(2-amino-2-oxoethyl)-4-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate |
|---|---|
| PubChem CID | 88955263 |
| Molecular Formula | C20H38N6O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | ethyl 2-[8,11-bis(2-amino-2-oxoethyl)-4-(2-oxoethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCCN(CC(N)=O)CCN(CC(N)=O)CCCN(CC=O)CC1 |
| InChI | InChI=1S/C20H38N6O5/c1-2-31-20(30)17-26-8-4-7-25(16-19(22)29)12-11-24(15-18(21)28)6-3-5-23(9-10-26)13-14-27/h14H,2-13,15-17H2,1H3,(H2,21,28)(H2,22,29) |
| InChIKey | ASSSRXLYKAHNAM-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|