C20H30BrNO3 — CID 170312873
ethyl 2-[(3R)-3-[4-(3-bromo-2-methylphenoxy)butyl]piperidin-1-yl]acetate (PubChem CID 170312873) has the molecular formula C20H30BrNO3 and a molecular weight of 412.37 g/mol. Its IUPAC name is ethyl 2-[(3R)-3-[4-(3-bromo-2-methylphenoxy)butyl]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[(3R)-3-[4-(3-bromo-2-methylphenoxy)butyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 170312873 |
| Molecular Formula | C20H30BrNO3 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl 2-[(3R)-3-[4-(3-bromo-2-methylphenoxy)butyl]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC[C@@H](CCCCOc2cccc(Br)c2C)C1 |
| InChI | InChI=1S/C20H30BrNO3/c1-3-24-20(23)15-22-12-7-9-17(14-22)8-4-5-13-25-19-11-6-10-18(21)16(19)2/h6,10-11,17H,3-5,7-9,12-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | RJLBCWZILJSNGB-QGZVFWFLSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|