C26H49BrN2O5 — CID 160709457
tert-butyl 4-(3-bromopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate (PubChem CID 160709457) has the molecular formula C26H49BrN2O5 and a molecular weight of 549.59 g/mol. Its IUPAC name is tert-butyl 4-(3-bromopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-bromopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160709457 |
| Molecular Formula | C26H49BrN2O5 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | tert-butyl 4-(3-bromopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-hydroxypropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCBr)CC1.CC(C)(C)OC(=O)N1CCC(CCCO)CC1 |
| InChI | InChI=1S/C13H24BrNO2.C13H25NO3/c1-13(2,3)17-12(16)15-9-6-11(7-10-15)5-4-8-14;1-13(2,3)17-12(16)14-8-6-11(7-9-14)5-4-10-15/h11H,4-10H2,1-3H3;11,15H,4-10H2,1-3H3 |
| InChIKey | RRQUYAXSWGLHCJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|