About ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate
ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate (PubChem CID 143188885) has the molecular formula C18H41NO3
and a molecular weight of 319.53 g/mol. Its IUPAC name is ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate |
| PubChem CID | 143188885 |
| Molecular Formula | C18H41NO3 |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.31 |
| IUPAC Name | ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate |
| SMILES | CC.CC.CC.CC(C)OC(=O)N1CCC(CCCO)CC1 |
| InChI | InChI=1S/C12H23NO3.3C2H6/c1-10(2)16-12(15)13-7-5-11(6-8-13)4-3-9-14;3*1-2/h10-11,14H,3-9H2,1-2H3;3*1-2H3 |
| InChIKey | REJGMHUBTGZBNR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate?
The IUPAC name of ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate (CID 143188885) is ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate.
What is the SMILES notation for ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate?
The canonical SMILES for ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate is CC.CC.CC.CC(C)OC(=O)N1CCC(CCCO)CC1.
What is the InChIKey of ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate?
The InChIKey is REJGMHUBTGZBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3.3C2H6/c1-10(2)16-12(15)13-7-5-11(6-8-13)4-3-9-14;3*1-2/h10-11,14H,3-9H2,1-2H3;3*1-2H3.
What are the key properties of ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate?
ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate has a molecular weight of 319.53 g/mol, XLogP of 5.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 4-(3-hydroxypropyl)piperidine-1-carboxylate is sourced from PubChem (CID 143188885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).