C24H45NO2Si — CID 178018979
tert-butyl 4-[5-tri(propan-2-yl)silylpent-4-ynyl]piperidine-1-carboxylate (PubChem CID 178018979) has the molecular formula C24H45NO2Si and a molecular weight of 407.72 g/mol. Its IUPAC name is tert-butyl 4-[5-tri(propan-2-yl)silylpent-4-ynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-tri(propan-2-yl)silylpent-4-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178018979 |
| Molecular Formula | C24H45NO2Si |
| Molecular Weight | 407.72 g/mol |
| Exact Mass | 407.32 |
| IUPAC Name | tert-butyl 4-[5-tri(propan-2-yl)silylpent-4-ynyl]piperidine-1-carboxylate |
| SMILES | CC(C)[Si](C#CCCCC1CCN(C(=O)OC(C)(C)C)CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H45NO2Si/c1-19(2)28(20(3)4,21(5)6)18-12-10-11-13-22-14-16-25(17-15-22)23(26)27-24(7,8)9/h19-22H,10-11,13-17H2,1-9H3 |
| InChIKey | VJGXKNOSKHQWFT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.72 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|