C19H33FN2O4S — CID 143388183
molecular hydrogen;propan-2-yl 4-[3-(3-fluoro-4-methylsulfinylanilino)propyl]piperidine-1-carboxylate;hydrate (PubChem CID 143388183) has the molecular formula C19H33FN2O4S and a molecular weight of 404.55 g/mol. Its IUPAC name is molecular hydrogen;propan-2-yl 4-[3-(3-fluoro-4-methylsulfinylanilino)propyl]piperidine-1-carboxylate;hydrate.
| Compound Name | molecular hydrogen;propan-2-yl 4-[3-(3-fluoro-4-methylsulfinylanilino)propyl]piperidine-1-carboxylate;hydrate |
|---|---|
| PubChem CID | 143388183 |
| Molecular Formula | C19H33FN2O4S |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | molecular hydrogen;propan-2-yl 4-[3-(3-fluoro-4-methylsulfinylanilino)propyl]piperidine-1-carboxylate;hydrate |
| SMILES | CC(C)OC(=O)N1CCC(CCCNc2ccc(S(C)=O)c(F)c2)CC1.O.[H][H] |
| InChI | InChI=1S/C19H29FN2O3S.H2O.H2/c1-14(2)25-19(23)22-11-8-15(9-12-22)5-4-10-21-16-6-7-18(26(3)24)17(20)13-16;;/h6-7,13-15,21H,4-5,8-12H2,1-3H3;1H2;1H |
| InChIKey | CWGXLCHWPNBOQA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|