C21H28FN3O3 — CID 89383954
tert-butyl 4-[3-(4-carbonocyanidoyl-3-fluoroanilino)propyl]piperidine-1-carboxylate (PubChem CID 89383954) has the molecular formula C21H28FN3O3 and a molecular weight of 389.47 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-carbonocyanidoyl-3-fluoroanilino)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4-carbonocyanidoyl-3-fluoroanilino)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89383954 |
| Molecular Formula | C21H28FN3O3 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | tert-butyl 4-[3-(4-carbonocyanidoyl-3-fluoroanilino)propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCNc2ccc(C(=O)C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C21H28FN3O3/c1-21(2,3)28-20(27)25-11-8-15(9-12-25)5-4-10-24-16-6-7-17(18(22)13-16)19(26)14-23/h6-7,13,15,24H,4-5,8-12H2,1-3H3 |
| InChIKey | FGPBFHJHMJBSEP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|