C21H32BrNO3 — CID 170529763
tert-butyl (2R,4S)-4-[3-(4-bromo-3-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylate (PubChem CID 170529763) has the molecular formula C21H32BrNO3 and a molecular weight of 426.40 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-[3-(4-bromo-3-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-[3-(4-bromo-3-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170529763 |
| Molecular Formula | C21H32BrNO3 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | tert-butyl (2R,4S)-4-[3-(4-bromo-3-methylphenoxy)propyl]-2-methylpiperidine-1-carboxylate |
| SMILES | Cc1cc(OCCC[C@H]2CCN(C(=O)OC(C)(C)C)[C@H](C)C2)ccc1Br |
| InChI | InChI=1S/C21H32BrNO3/c1-15-13-18(8-9-19(15)22)25-12-6-7-17-10-11-23(16(2)14-17)20(24)26-21(3,4)5/h8-9,13,16-17H,6-7,10-12,14H2,1-5H3/t16-,17+/m1/s1 |
| InChIKey | GAGLKNBRRDWQEK-SJORKVTESA-N |
| XLogP | 5.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|