C34H56N4O8 — CID 145192224
tert-butyl N-(5-hydroxy-3-methylpentyl)carbamate;tert-butyl 4-[2-(8-nitroquinolin-6-yl)oxyethyl]piperidine-1-carboxylate;ethane (PubChem CID 145192224) has the molecular formula C34H56N4O8 and a molecular weight of 648.84 g/mol. Its IUPAC name is tert-butyl N-(5-hydroxy-3-methylpentyl)carbamate;tert-butyl 4-[2-(8-nitroquinolin-6-yl)oxyethyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl N-(5-hydroxy-3-methylpentyl)carbamate;tert-butyl 4-[2-(8-nitroquinolin-6-yl)oxyethyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145192224 |
| Molecular Formula | C34H56N4O8 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.41 |
| IUPAC Name | tert-butyl N-(5-hydroxy-3-methylpentyl)carbamate;tert-butyl 4-[2-(8-nitroquinolin-6-yl)oxyethyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(CCOc2cc([N+](=O)[O-])c3ncccc3c2)CC1.CC(CCO)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27N3O5.C11H23NO3.C2H6/c1-21(2,3)29-20(25)23-10-6-15(7-11-23)8-12-28-17-13-16-5-4-9-22-19(16)18(14-17)24(26)27;1-9(6-8-13)5-7-12-10(14)15-11(2,3)4;1-2/h4-5,9,13-15H,6-8,10-12H2,1-3H3;9,13H,5-8H2,1-4H3,(H,12,14);1-2H3 |
| InChIKey | KMXAHFLPNBQUJI-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|