C18H25BrN2O4 — CID 156761300
4-bromo-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methylamino]benzoic acid (PubChem CID 156761300) has the molecular formula C18H25BrN2O4 and a molecular weight of 413.31 g/mol. Its IUPAC name is 4-bromo-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methylamino]benzoic acid.
| Compound Name | 4-bromo-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 156761300 |
| Molecular Formula | C18H25BrN2O4 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 4-bromo-3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methylamino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2cc(C(=O)O)ccc2Br)CC1 |
| InChI | InChI=1S/C18H25BrN2O4/c1-18(2,3)25-17(24)21-8-6-12(7-9-21)11-20-15-10-13(16(22)23)4-5-14(15)19/h4-5,10,12,20H,6-9,11H2,1-3H3,(H,22,23) |
| InChIKey | DXLCXELWAOAKJM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |