C17H23BrCl2N2O2 — CID 114001569
tert-butyl 4-[(4-bromo-2,3-dichloroanilino)methyl]piperidine-1-carboxylate (PubChem CID 114001569) has the molecular formula C17H23BrCl2N2O2 and a molecular weight of 438.19 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromo-2,3-dichloroanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromo-2,3-dichloroanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 114001569 |
| Molecular Formula | C17H23BrCl2N2O2 |
| Molecular Weight | 438.19 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | tert-butyl 4-[(4-bromo-2,3-dichloroanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2ccc(Br)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C17H23BrCl2N2O2/c1-17(2,3)24-16(23)22-8-6-11(7-9-22)10-21-13-5-4-12(18)14(19)15(13)20/h4-5,11,21H,6-10H2,1-3H3 |
| InChIKey | KVPGHLSQVXDDHI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.19 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|