C30H28ClN5O5S2 — CID 22730080
4-(5-chloro-2-pyridinyl)-N-[3-nitro-4-[(4-phenylsulfanylpiperidin-4-yl)methylamino]phenyl]sulfonylbenzamide (PubChem CID 22730080) has the molecular formula C30H28ClN5O5S2 and a molecular weight of 638.17 g/mol. Its IUPAC name is 4-(5-chloro-2-pyridinyl)-N-[3-nitro-4-[(4-phenylsulfanylpiperidin-4-yl)methylamino]phenyl]sulfonylbenzamide.
| Compound Name | 4-(5-chloro-2-pyridinyl)-N-[3-nitro-4-[(4-phenylsulfanylpiperidin-4-yl)methylamino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730080 |
| Molecular Formula | C30H28ClN5O5S2 |
| Molecular Weight | 638.17 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | 4-(5-chloro-2-pyridinyl)-N-[3-nitro-4-[(4-phenylsulfanylpiperidin-4-yl)methylamino]phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2(Sc3ccccc3)CCNCC2)c([N+](=O)[O-])c1)c1ccc(-c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C30H28ClN5O5S2/c31-23-10-12-26(33-19-23)21-6-8-22(9-7-21)29(37)35-43(40,41)25-11-13-27(28(18-25)36(38)39)34-20-30(14-16-32-17-15-30)42-24-4-2-1-3-5-24/h1-13,18-19,32,34H,14-17,20H2,(H,35,37) |
| InChIKey | MONHMQUSRVYADC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.17 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|