C19H20F2N4O5S — CID 156699801
N-[3-fluoro-4-[(4-fluoropiperidin-4-yl)methylamino]-5-nitrophenyl]sulfonylbenzamide (PubChem CID 156699801) has the molecular formula C19H20F2N4O5S and a molecular weight of 454.46 g/mol. Its IUPAC name is N-[3-fluoro-4-[(4-fluoropiperidin-4-yl)methylamino]-5-nitrophenyl]sulfonylbenzamide.
| Compound Name | N-[3-fluoro-4-[(4-fluoropiperidin-4-yl)methylamino]-5-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 156699801 |
| Molecular Formula | C19H20F2N4O5S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[3-fluoro-4-[(4-fluoropiperidin-4-yl)methylamino]-5-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1cc(F)c(NCC2(F)CCNCC2)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C19H20F2N4O5S/c20-15-10-14(31(29,30)24-18(26)13-4-2-1-3-5-13)11-16(25(27)28)17(15)23-12-19(21)6-8-22-9-7-19/h1-5,10-11,22-23H,6-9,12H2,(H,24,26) |
| InChIKey | ZYAMTOPFURRSFL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|