C39H47ClF2N6O6S — CID 156699809
N-[4-[(1-acetyl-4-fluoropiperidin-4-yl)methylamino]-3-fluoro-5-nitrophenyl]sulfonyl-4-[4-[3-(4-chlorophenyl)-2,5-dimethylhex-2-enyl]piperazin-1-yl]benzamide (PubChem CID 156699809) has the molecular formula C39H47ClF2N6O6S and a molecular weight of 801.36 g/mol. Its IUPAC name is N-[4-[(1-acetyl-4-fluoropiperidin-4-yl)methylamino]-3-fluoro-5-nitrophenyl]sulfonyl-4-[4-[3-(4-chlorophenyl)-2,5-dimethylhex-2-enyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-[(1-acetyl-4-fluoropiperidin-4-yl)methylamino]-3-fluoro-5-nitrophenyl]sulfonyl-4-[4-[3-(4-chlorophenyl)-2,5-dimethylhex-2-enyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 156699809 |
| Molecular Formula | C39H47ClF2N6O6S |
| Molecular Weight | 801.36 g/mol |
| Exact Mass | 800.29 |
| IUPAC Name | N-[4-[(1-acetyl-4-fluoropiperidin-4-yl)methylamino]-3-fluoro-5-nitrophenyl]sulfonyl-4-[4-[3-(4-chlorophenyl)-2,5-dimethylhex-2-enyl]piperazin-1-yl]benzamide |
| SMILES | CC(=O)N1CCC(F)(CNc2c(F)cc(S(=O)(=O)NC(=O)c3ccc(N4CCN(CC(C)=C(CC(C)C)c5ccc(Cl)cc5)CC4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C39H47ClF2N6O6S/c1-26(2)21-34(29-5-9-31(40)10-6-29)27(3)24-45-17-19-47(20-18-45)32-11-7-30(8-12-32)38(50)44-55(53,54)33-22-35(41)37(36(23-33)48(51)52)43-25-39(42)13-15-46(16-14-39)28(4)49/h5-12,22-23,26,43H,13-21,24-25H2,1-4H3,(H,44,50) |
| InChIKey | XMUGEDRANQWJHF-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.36 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|