C21H23N3O6S — CID 152770831
4-(2-azaspiro[4.4]nonan-2-yl)-N-(4-hydroxy-3-nitrophenyl)sulfonylbenzamide (PubChem CID 152770831) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-(2-azaspiro[4.4]nonan-2-yl)-N-(4-hydroxy-3-nitrophenyl)sulfonylbenzamide.
| Compound Name | 4-(2-azaspiro[4.4]nonan-2-yl)-N-(4-hydroxy-3-nitrophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 152770831 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-(2-azaspiro[4.4]nonan-2-yl)-N-(4-hydroxy-3-nitrophenyl)sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1)c1ccc(N2CCC3(CCCC3)C2)cc1 |
| InChI | InChI=1S/C21H23N3O6S/c25-19-8-7-17(13-18(19)24(27)28)31(29,30)22-20(26)15-3-5-16(6-4-15)23-12-11-21(14-23)9-1-2-10-21/h3-8,13,25H,1-2,9-12,14H2,(H,22,26) |
| InChIKey | GTUDCKJVEYDLHJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|