C45H54N4O5S — CID 53482440
N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-[3-phenylpropyl-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzamide (PubChem CID 53482440) has the molecular formula C45H54N4O5S and a molecular weight of 763.02 g/mol. Its IUPAC name is N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-[3-phenylpropyl-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzamide.
| Compound Name | N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-[3-phenylpropyl-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 53482440 |
| Molecular Formula | C45H54N4O5S |
| Molecular Weight | 763.02 g/mol |
| Exact Mass | 762.38 |
| IUPAC Name | N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-[3-phenylpropyl-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]benzamide |
| SMILES | C[C@@H]1C(N(CCCc2ccccc2)c2ccc(-c3ccc(C(=O)NS(=O)(=O)c4ccc(NCC5CCCCC5)c([N+](=O)[O-])c4)cc3)cc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C45H54N4O5S/c1-31-40-27-37(45(40,2)3)28-42(31)48(26-10-15-32-11-6-4-7-12-32)38-22-20-35(21-23-38)34-16-18-36(19-17-34)44(50)47-55(53,54)39-24-25-41(43(29-39)49(51)52)46-30-33-13-8-5-9-14-33/h4,6-7,11-12,16-25,29,31,33,37,40,42,46H,5,8-10,13-15,26-28,30H2,1-3H3,(H,47,50)/t31-,37+,40-,42?/m0/s1 |
| InChIKey | CGGAAQQEXDIUTB-SWNGAGOASA-N |
| XLogP | 9.88 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.02 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|