C41H45N3O6S — CID 123484553
N-[3-(1-adamantyl)-4-methoxyphenyl]-N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylnaphthalene-2-carboxamide (PubChem CID 123484553) has the molecular formula C41H45N3O6S and a molecular weight of 707.89 g/mol. Its IUPAC name is N-[3-(1-adamantyl)-4-methoxyphenyl]-N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylnaphthalene-2-carboxamide.
| Compound Name | N-[3-(1-adamantyl)-4-methoxyphenyl]-N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 123484553 |
| Molecular Formula | C41H45N3O6S |
| Molecular Weight | 707.89 g/mol |
| Exact Mass | 707.30 |
| IUPAC Name | N-[3-(1-adamantyl)-4-methoxyphenyl]-N-[4-(cyclohexylmethylamino)-3-nitrophenyl]sulfonylnaphthalene-2-carboxamide |
| SMILES | COc1ccc(N(C(=O)c2ccc3ccccc3c2)S(=O)(=O)c2ccc(NCC3CCCCC3)c([N+](=O)[O-])c2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C41H45N3O6S/c1-50-39-16-13-34(21-36(39)41-23-28-17-29(24-41)19-30(18-28)25-41)43(40(45)33-12-11-31-9-5-6-10-32(31)20-33)51(48,49)35-14-15-37(38(22-35)44(46)47)42-26-27-7-3-2-4-8-27/h5-6,9-16,20-22,27-30,42H,2-4,7-8,17-19,23-26H2,1H3 |
| InChIKey | VLSDNELJYDGNRN-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.89 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|