C28H27FN4O7S — CID 87316616
N-[(6-fluoro-1H-indol-5-yl)oxy]-N-[4-[(4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 87316616) has the molecular formula C28H27FN4O7S and a molecular weight of 582.61 g/mol. Its IUPAC name is N-[(6-fluoro-1H-indol-5-yl)oxy]-N-[4-[(4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | N-[(6-fluoro-1H-indol-5-yl)oxy]-N-[4-[(4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 87316616 |
| Molecular Formula | C28H27FN4O7S |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | N-[(6-fluoro-1H-indol-5-yl)oxy]-N-[4-[(4-hydroxycyclohexyl)methylamino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(c1ccccc1)N(Oc1cc2cc[nH]c2cc1F)S(=O)(=O)c1ccc(NCC2CCC(O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H27FN4O7S/c29-23-16-25-20(12-13-30-25)14-27(23)40-33(28(35)19-4-2-1-3-5-19)41(38,39)22-10-11-24(26(15-22)32(36)37)31-17-18-6-8-21(34)9-7-18/h1-5,10-16,18,21,30-31,34H,6-9,17H2 |
| InChIKey | MSHVFWDLDGTIBB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 154.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|