C16H21FN2O5 — CID 70856081
methyl 4-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]cyclohexane-1-carboxylate (PubChem CID 70856081) has the molecular formula C16H21FN2O5 and a molecular weight of 340.35 g/mol. Its IUPAC name is methyl 4-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70856081 |
| Molecular Formula | C16H21FN2O5 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl 4-[(4-fluoro-5-methoxy-2-nitroanilino)methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(CNc2cc(OC)c(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H21FN2O5/c1-23-15-8-13(14(19(21)22)7-12(15)17)18-9-10-3-5-11(6-4-10)16(20)24-2/h7-8,10-11,18H,3-6,9H2,1-2H3 |
| InChIKey | WSZYDUZFMDOHEJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|