C17H22N2O7 — CID 155437834
methyl 4-[(2,5-dimethoxy-4-nitrophenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 155437834) has the molecular formula C17H22N2O7 and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl 4-[(2,5-dimethoxy-4-nitrophenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(2,5-dimethoxy-4-nitrophenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155437834 |
| Molecular Formula | C17H22N2O7 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | methyl 4-[(2,5-dimethoxy-4-nitrophenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C(=O)Nc2cc(OC)c([N+](=O)[O-])cc2OC)CC1 |
| InChI | InChI=1S/C17H22N2O7/c1-24-14-9-13(19(22)23)15(25-2)8-12(14)18-16(20)10-4-6-11(7-5-10)17(21)26-3/h8-11H,4-7H2,1-3H3,(H,18,20) |
| InChIKey | KAFBYIOHDRSVJY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|